C21H25F3NO6P — CID 67375060
2-(3-aminophenyl)-3-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67375060) has the molecular formula C21H25F3NO6P and a molecular weight of 475.40 g/mol. Its IUPAC name is 2-(3-aminophenyl)-3-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(3-aminophenyl)-3-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67375060 |
| Molecular Formula | C21H25F3NO6P |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-(3-aminophenyl)-3-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cccc(C(CP(=O)(O)CCCCc2ccccc2)C(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24NO4P.C2HF3O2/c20-17-11-6-10-16(13-17)18(19(21)22)14-25(23,24)12-5-4-9-15-7-2-1-3-8-15;3-2(4,5)1(6)7/h1-3,6-8,10-11,13,18H,4-5,9,12,14,20H2,(H,21,22)(H,23,24);(H,6,7) |
| InChIKey | QRWQEOFYCOCVJF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|