About 2-(2,4,6-trimethylanilino)ethanol
2-(2,4,6-trimethylanilino)ethanol (PubChem CID 67375569) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-(2,4,6-trimethylanilino)ethanol.
Molecular Properties
| Compound Name | 2-(2,4,6-trimethylanilino)ethanol |
| PubChem CID | 67375569 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-(2,4,6-trimethylanilino)ethanol |
| SMILES | Cc1cc(C)c(NCCO)c(C)c1 |
| InChI | InChI=1S/C11H17NO/c1-8-6-9(2)11(10(3)7-8)12-4-5-13/h6-7,12-13H,4-5H2,1-3H3 |
| InChIKey | FJFKCRPFQLGPNA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4,6-trimethylanilino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,6-trimethylanilino)ethanol?
The IUPAC name of 2-(2,4,6-trimethylanilino)ethanol (CID 67375569) is 2-(2,4,6-trimethylanilino)ethanol.
What is the SMILES notation for 2-(2,4,6-trimethylanilino)ethanol?
The canonical SMILES for 2-(2,4,6-trimethylanilino)ethanol is Cc1cc(C)c(NCCO)c(C)c1.
What is the InChIKey of 2-(2,4,6-trimethylanilino)ethanol?
The InChIKey is FJFKCRPFQLGPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-8-6-9(2)11(10(3)7-8)12-4-5-13/h6-7,12-13H,4-5H2,1-3H3.
What are the key properties of 2-(2,4,6-trimethylanilino)ethanol?
2-(2,4,6-trimethylanilino)ethanol has a molecular weight of 179.26 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-trimethylanilino)ethanol is sourced from PubChem (CID 67375569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).