About 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole
1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole (PubChem CID 67375811) has the molecular formula C36H38N2O2
and a molecular weight of 530.71 g/mol. Its IUPAC name is 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole.
Molecular Properties
| Compound Name | 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole |
| PubChem CID | 67375811 |
| Molecular Formula | C36H38N2O2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole |
| SMILES | C=CCCn1c(-c2ccccc2)c(C2CCCCC2)c2c(C)cc(C(=O)O)c(C=C)c21.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C28H31NO2.C8H7N/c1-4-6-17-29-26(21-15-11-8-12-16-21)25(20-13-9-7-10-14-20)24-19(3)18-23(28(30)31)22(5-2)27(24)29;1-2-4-8-7(3-1)5-6-9-8/h4-5,8,11-12,15-16,18,20H,1-2,6-7,9-10,13-14,17H2,3H3,(H,30,31);1-6,9H |
| InChIKey | AQBKAQJBXFZCMB-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole?
The IUPAC name of 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole (CID 67375811) is 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole.
What is the SMILES notation for 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole?
The canonical SMILES for 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole is C=CCCn1c(-c2ccccc2)c(C2CCCCC2)c2c(C)cc(C(=O)O)c(C=C)c21.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole?
The InChIKey is AQBKAQJBXFZCMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31NO2.C8H7N/c1-4-6-17-29-26(21-15-11-8-12-16-21)25(20-13-9-7-10-14-20)24-19(3)18-23(28(30)31)22(5-2)27(24)29;1-2-4-8-7(3-1)5-6-9-8/h4-5,8,11-12,15-16,18,20H,1-2,6-7,9-10,13-14,17H2,3H3,(H,30,31);1-6,9H.
What are the key properties of 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole?
1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole has a molecular weight of 530.71 g/mol, XLogP of 9.75, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-enyl-3-cyclohexyl-7-ethenyl-4-methyl-2-phenylindole-6-carboxylic acid;1H-indole is sourced from PubChem (CID 67375811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).