C19H14FN3O3 — CID 67376186
15-fluoro-4-(4-oxopiperidin-1-yl)-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one (PubChem CID 67376186) has the molecular formula C19H14FN3O3 and a molecular weight of 351.34 g/mol. Its IUPAC name is 15-fluoro-4-(4-oxopiperidin-1-yl)-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one.
| Compound Name | 15-fluoro-4-(4-oxopiperidin-1-yl)-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 67376186 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 15-fluoro-4-(4-oxopiperidin-1-yl)-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
| SMILES | O=C1CCN(c2nc3c4ccc(F)cc4c4c(=O)[nH]ccc4c3o2)CC1 |
| InChI | InChI=1S/C19H14FN3O3/c20-10-1-2-12-14(9-10)15-13(3-6-21-18(15)25)17-16(12)22-19(26-17)23-7-4-11(24)5-8-23/h1-3,6,9H,4-5,7-8H2,(H,21,25) |
| InChIKey | JPWQJJFEPXSOIU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|