C27H39N3O2S — CID 67376537
N-(3-cyclohexylsulfanylpropyl)-3-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-3-carboxamide (PubChem CID 67376537) has the molecular formula C27H39N3O2S and a molecular weight of 469.70 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-3-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-3-carboxamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-3-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67376537 |
| Molecular Formula | C27H39N3O2S |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-3-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1-c1nc(CC2(C(=O)NCCCSC3CCCCC3)CCCNC2)c(C)o1 |
| InChI | InChI=1S/C27H39N3O2S/c1-20-10-6-7-13-23(20)25-30-24(21(2)32-25)18-27(14-8-15-28-19-27)26(31)29-16-9-17-33-22-11-4-3-5-12-22/h6-7,10,13,22,28H,3-5,8-9,11-12,14-19H2,1-2H3,(H,29,31) |
| InChIKey | YGXKECVAYFLJBB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|