C24H39N5O2Si — CID 67376602
tert-butyl-[2-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethoxy]-dimethylsilane;4-methoxycinnoline-3-carbonitrile (PubChem CID 67376602) has the molecular formula C24H39N5O2Si and a molecular weight of 457.70 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethoxy]-dimethylsilane;4-methoxycinnoline-3-carbonitrile.
| Compound Name | tert-butyl-[2-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethoxy]-dimethylsilane;4-methoxycinnoline-3-carbonitrile |
|---|---|
| PubChem CID | 67376602 |
| Molecular Formula | C24H39N5O2Si |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | tert-butyl-[2-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethoxy]-dimethylsilane;4-methoxycinnoline-3-carbonitrile |
| SMILES | COc1c(C#N)nnc2ccccc12.C[C@@H]1CNC[C@H](C)N1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H32N2OSi.C10H7N3O/c1-12-10-15-11-13(2)16(12)8-9-17-18(6,7)14(3,4)5;1-14-10-7-4-2-3-5-8(7)12-13-9(10)6-11/h12-13,15H,8-11H2,1-7H3;2-5H,1H3/t12-,13+; |
| InChIKey | TUSDQSDGENCYAC-OEEJBDNKSA-N |
| XLogP | 4.20 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|