About 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide
5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide (PubChem CID 67376711) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide |
| PubChem CID | 67376711 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)C1=C(c2ccncc2)NNC1 |
| InChI | InChI=1S/C9H10N4O/c10-9(14)7-5-12-13-8(7)6-1-3-11-4-2-6/h1-4,12-13H,5H2,(H2,10,14) |
| InChIKey | HDMBYGCFMRGKJP-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide (CID 67376711) is 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide is NC(=O)C1=C(c2ccncc2)NNC1.
What is the InChIKey of 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide?
The InChIKey is HDMBYGCFMRGKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c10-9(14)7-5-12-13-8(7)6-1-3-11-4-2-6/h1-4,12-13H,5H2,(H2,10,14).
What are the key properties of 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide?
5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide has a molecular weight of 190.21 g/mol, XLogP of -0.61, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-4-yl-2,3-dihydro-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 67376711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).