C16H19F3N2O3 — CID 67376891
(2R)-2-butanoyl-1-(methylamino)-3-(2,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 67376891) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is (2R)-2-butanoyl-1-(methylamino)-3-(2,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-butanoyl-1-(methylamino)-3-(2,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67376891 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2R)-2-butanoyl-1-(methylamino)-3-(2,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCCC(=O)[C@@]1(C(=O)O)C(c2cc(F)c(F)cc2F)CCN1NC |
| InChI | InChI=1S/C16H19F3N2O3/c1-3-4-14(22)16(15(23)24)10(5-6-21(16)20-2)9-7-12(18)13(19)8-11(9)17/h7-8,10,20H,3-6H2,1-2H3,(H,23,24)/t10?,16-/m1/s1 |
| InChIKey | OSTRBDNGHASZAQ-YRQZNCJOSA-N |
| XLogP | 2.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|