C19H22N4O4 — CID 67376976
[2-oxo-2-[4-(5-phenylmethoxy-2-pyridinyl)piperazin-1-yl]ethyl] carbamate (PubChem CID 67376976) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-oxo-2-[4-(5-phenylmethoxy-2-pyridinyl)piperazin-1-yl]ethyl] carbamate.
| Compound Name | [2-oxo-2-[4-(5-phenylmethoxy-2-pyridinyl)piperazin-1-yl]ethyl] carbamate |
|---|---|
| PubChem CID | 67376976 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2-oxo-2-[4-(5-phenylmethoxy-2-pyridinyl)piperazin-1-yl]ethyl] carbamate |
| SMILES | NC(=O)OCC(=O)N1CCN(c2ccc(OCc3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C19H22N4O4/c20-19(25)27-14-18(24)23-10-8-22(9-11-23)17-7-6-16(12-21-17)26-13-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H2,20,25) |
| InChIKey | PRMLQOPHANFNDJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |