C20H16F3N3O2S — CID 67377117
16-[4-(trifluoromethyl)phenyl]sulfonyl-12,13,16-triazatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4,6,10(14),11-pentaene (PubChem CID 67377117) has the molecular formula C20H16F3N3O2S and a molecular weight of 419.43 g/mol. Its IUPAC name is 16-[4-(trifluoromethyl)phenyl]sulfonyl-12,13,16-triazatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4,6,10(14),11-pentaene.
| Compound Name | 16-[4-(trifluoromethyl)phenyl]sulfonyl-12,13,16-triazatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4,6,10(14),11-pentaene |
|---|---|
| PubChem CID | 67377117 |
| Molecular Formula | C20H16F3N3O2S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 16-[4-(trifluoromethyl)phenyl]sulfonyl-12,13,16-triazatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4,6,10(14),11-pentaene |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1C2Cc3[nH]ncc3C1Cc1ccccc12 |
| InChI | InChI=1S/C20H16F3N3O2S/c21-20(22,23)13-5-7-14(8-6-13)29(27,28)26-18-9-12-3-1-2-4-15(12)19(26)10-17-16(18)11-24-25-17/h1-8,11,18-19H,9-10H2,(H,24,25) |
| InChIKey | MXTAXDQUAASAIJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |