C42H47N3O10 — CID 67377124
2-[4-[6-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 67377124) has the molecular formula C42H47N3O10 and a molecular weight of 753.85 g/mol. Its IUPAC name is 2-[4-[6-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[6-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 67377124 |
| Molecular Formula | C42H47N3O10 |
| Molecular Weight | 753.85 g/mol |
| Exact Mass | 753.33 |
| IUPAC Name | 2-[4-[6-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(C2NC(=O)c3cc(C)ccc3N2)ccc1OCCCCCCOc1c(OC)cc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)on2)cc1OC |
| InChI | InChI=1S/C42H47N3O10/c1-25-12-14-30-29(18-25)42(46)44-41(43-30)26-13-15-32(34(19-26)47-2)53-16-10-8-9-11-17-54-40-37(50-5)20-27(21-38(40)51-6)31-24-33(55-45-31)28-22-35(48-3)39(52-7)36(23-28)49-4/h12-15,18-24,41,43H,8-11,16-17H2,1-7H3,(H,44,46) |
| InChIKey | SIGQKTILGOPTBR-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.85 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|