C43H50ClN3O8 — CID 67377152
3-[3-[9-[4-(6-chloro-1,2,3,4-tetrahydroquinazolin-2-yl)-2-methoxyphenoxy]nonoxy]-4-methoxyphenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 67377152) has the molecular formula C43H50ClN3O8 and a molecular weight of 772.34 g/mol. Its IUPAC name is 3-[3-[9-[4-(6-chloro-1,2,3,4-tetrahydroquinazolin-2-yl)-2-methoxyphenoxy]nonoxy]-4-methoxyphenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole.
| Compound Name | 3-[3-[9-[4-(6-chloro-1,2,3,4-tetrahydroquinazolin-2-yl)-2-methoxyphenoxy]nonoxy]-4-methoxyphenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 67377152 |
| Molecular Formula | C43H50ClN3O8 |
| Molecular Weight | 772.34 g/mol |
| Exact Mass | 771.33 |
| IUPAC Name | 3-[3-[9-[4-(6-chloro-1,2,3,4-tetrahydroquinazolin-2-yl)-2-methoxyphenoxy]nonoxy]-4-methoxyphenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1cc(C2NCc3cc(Cl)ccc3N2)ccc1OCCCCCCCCCOc1cc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)on2)ccc1OC |
| InChI | InChI=1S/C43H50ClN3O8/c1-48-35-17-13-28(34-26-37(55-47-34)30-24-40(50-3)42(52-5)41(25-30)51-4)22-39(35)54-20-12-10-8-6-7-9-11-19-53-36-18-14-29(23-38(36)49-2)43-45-27-31-21-32(44)15-16-33(31)46-43/h13-18,21-26,43,45-46H,6-12,19-20,27H2,1-5H3 |
| InChIKey | SZEIQQGMEWCILF-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.34 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|