C42H50N2O9 — CID 67377181
6-methoxy-2-[3-methoxy-4-[8-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 67377181) has the molecular formula C42H50N2O9 and a molecular weight of 726.87 g/mol. Its IUPAC name is 6-methoxy-2-[3-methoxy-4-[8-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 6-methoxy-2-[3-methoxy-4-[8-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 67377181 |
| Molecular Formula | C42H50N2O9 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.35 |
| IUPAC Name | 6-methoxy-2-[3-methoxy-4-[8-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCCCCCCCCOc3cc(C=Cc4cc(OC)c(OC)c(OC)c4)ccc3OC)c(OC)c1)N2 |
| InChI | InChI=1S/C42H50N2O9/c1-46-31-17-18-33-32(27-31)42(45)44-41(43-33)30-16-20-35(36(26-30)48-3)52-21-11-9-7-8-10-12-22-53-37-23-28(15-19-34(37)47-2)13-14-29-24-38(49-4)40(51-6)39(25-29)50-5/h13-20,23-27,41,43H,7-12,21-22H2,1-6H3,(H,44,45) |
| InChIKey | GURGDXHZUBKOSC-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|