About 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine
8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine (PubChem CID 67377459) has the molecular formula C11H12IN3
and a molecular weight of 313.14 g/mol. Its IUPAC name is 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine.
Molecular Properties
| Compound Name | 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine |
| PubChem CID | 67377459 |
| Molecular Formula | C11H12IN3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine |
| SMILES | C=CCNc1ccn2cc(C)nc2c1I |
| InChI | InChI=1S/C11H12IN3/c1-3-5-13-9-4-6-15-7-8(2)14-11(15)10(9)12/h3-4,6-7,13H,1,5H2,2H3 |
| InChIKey | IHRCRDIEUIKXBJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine?
The IUPAC name of 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine (CID 67377459) is 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine.
What is the SMILES notation for 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine?
The canonical SMILES for 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine is C=CCNc1ccn2cc(C)nc2c1I.
What is the InChIKey of 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine?
The InChIKey is IHRCRDIEUIKXBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12IN3/c1-3-5-13-9-4-6-15-7-8(2)14-11(15)10(9)12/h3-4,6-7,13H,1,5H2,2H3.
What are the key properties of 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine?
8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine has a molecular weight of 313.14 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodo-2-methyl-N-prop-2-enylimidazo[1,2-a]pyridin-7-amine is sourced from PubChem (CID 67377459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).