C14H11N5O5S2 — CID 67377565
4-amino-N-(2-methylsulfonyl-5-nitrophenyl)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 67377565) has the molecular formula C14H11N5O5S2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 4-amino-N-(2-methylsulfonyl-5-nitrophenyl)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 4-amino-N-(2-methylsulfonyl-5-nitrophenyl)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 67377565 |
| Molecular Formula | C14H11N5O5S2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 4-amino-N-(2-methylsulfonyl-5-nitrophenyl)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | CS(=O)(=O)c1ccc([N+](=O)[O-])cc1NC(=O)c1csc2c(N)ncnc12 |
| InChI | InChI=1S/C14H11N5O5S2/c1-26(23,24)10-3-2-7(19(21)22)4-9(10)18-14(20)8-5-25-12-11(8)16-6-17-13(12)15/h2-6H,1H3,(H,18,20)(H2,15,16,17) |
| InChIKey | IANNVLLBGJVUIQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|