C15H23NS — CID 67377688
2,2,3,4-tetrakis(prop-2-enyl)-1,3-thiazolidine (PubChem CID 67377688) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 2,2,3,4-tetrakis(prop-2-enyl)-1,3-thiazolidine.
| Compound Name | 2,2,3,4-tetrakis(prop-2-enyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 67377688 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2,2,3,4-tetrakis(prop-2-enyl)-1,3-thiazolidine |
| SMILES | C=CCC1CSC(CC=C)(CC=C)N1CC=C |
| InChI | InChI=1S/C15H23NS/c1-5-9-14-13-17-15(10-6-2,11-7-3)16(14)12-8-4/h5-8,14H,1-4,9-13H2 |
| InChIKey | ZRLJUNSNQVZPPM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|