C11H12ClNO5S — CID 67378263
[(2-chlorocyclohexa-1,3-dien-1-yl)-(1,4-dioxin-2-yl)methyl]sulfamic acid (PubChem CID 67378263) has the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. Its IUPAC name is [(2-chlorocyclohexa-1,3-dien-1-yl)-(1,4-dioxin-2-yl)methyl]sulfamic acid.
| Compound Name | [(2-chlorocyclohexa-1,3-dien-1-yl)-(1,4-dioxin-2-yl)methyl]sulfamic acid |
|---|---|
| PubChem CID | 67378263 |
| Molecular Formula | C11H12ClNO5S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | [(2-chlorocyclohexa-1,3-dien-1-yl)-(1,4-dioxin-2-yl)methyl]sulfamic acid |
| SMILES | O=S(=O)(O)NC(C1=COC=CO1)C1=C(Cl)C=CCC1 |
| InChI | InChI=1S/C11H12ClNO5S/c12-9-4-2-1-3-8(9)11(13-19(14,15)16)10-7-17-5-6-18-10/h2,4-7,11,13H,1,3H2,(H,14,15,16) |
| InChIKey | QEUYLAORADJJPJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|