About 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol
7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol (PubChem CID 67378294) has the molecular formula C26H23NO2S
and a molecular weight of 413.54 g/mol. Its IUPAC name is 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol.
Molecular Properties
| Compound Name | 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol |
| PubChem CID | 67378294 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol |
| SMILES | Cc1cc(-c2ccsc2)cc2c1C(O)N(Cc1ccc(Oc3ccccc3)cc1)C2 |
| InChI | InChI=1S/C26H23NO2S/c1-18-13-21(20-11-12-30-17-20)14-22-16-27(26(28)25(18)22)15-19-7-9-24(10-8-19)29-23-5-3-2-4-6-23/h2-14,17,26,28H,15-16H2,1H3 |
| InChIKey | SUMZMVZPEUPXPL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol?
The IUPAC name of 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol (CID 67378294) is 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol.
What is the SMILES notation for 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol?
The canonical SMILES for 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol is Cc1cc(-c2ccsc2)cc2c1C(O)N(Cc1ccc(Oc3ccccc3)cc1)C2.
What is the InChIKey of 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol?
The InChIKey is SUMZMVZPEUPXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO2S/c1-18-13-21(20-11-12-30-17-20)14-22-16-27(26(28)25(18)22)15-19-7-9-24(10-8-19)29-23-5-3-2-4-6-23/h2-14,17,26,28H,15-16H2,1H3.
What are the key properties of 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol?
7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol has a molecular weight of 413.54 g/mol, XLogP of 6.52, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-[(4-phenoxyphenyl)methyl]-5-thiophen-3-yl-1,3-dihydroisoindol-1-ol is sourced from PubChem (CID 67378294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).