C25H20N6O2 — CID 67378301
N-[2-methyl-5-(7H-purin-6-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide (PubChem CID 67378301) has the molecular formula C25H20N6O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is N-[2-methyl-5-(7H-purin-6-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide.
| Compound Name | N-[2-methyl-5-(7H-purin-6-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 67378301 |
| Molecular Formula | C25H20N6O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[2-methyl-5-(7H-purin-6-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide |
| SMILES | Cc1ccc(-c2ncnc3nc[nH]c23)cc1NC(=O)c1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C25H20N6O2/c1-16-5-6-18(22-23-24(29-14-27-22)30-15-28-23)12-21(16)31-25(32)17-7-9-20(10-8-17)33-13-19-4-2-3-11-26-19/h2-12,14-15H,13H2,1H3,(H,31,32)(H,27,28,29,30) |
| InChIKey | UGRDXUPKHPRFPG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |