About 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol
3-pentyl-4,5-dihydro-1,2-oxazol-5-ol (PubChem CID 67379032) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol.
Molecular Properties
| Compound Name | 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol |
| PubChem CID | 67379032 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol |
| SMILES | CCCCCC1=NOC(O)C1 |
| InChI | InChI=1S/C8H15NO2/c1-2-3-4-5-7-6-8(10)11-9-7/h8,10H,2-6H2,1H3 |
| InChIKey | NYOMWPWPYXVCCN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol?
The IUPAC name of 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol (CID 67379032) is 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol.
What is the SMILES notation for 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol?
The canonical SMILES for 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol is CCCCCC1=NOC(O)C1.
What is the InChIKey of 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol?
The InChIKey is NYOMWPWPYXVCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-3-4-5-7-6-8(10)11-9-7/h8,10H,2-6H2,1H3.
What are the key properties of 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol?
3-pentyl-4,5-dihydro-1,2-oxazol-5-ol has a molecular weight of 157.21 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-4,5-dihydro-1,2-oxazol-5-ol is sourced from PubChem (CID 67379032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).