C17H17ClFNO4S — CID 67379040
benzyl 4-chloro-2-fluoro-3-(propylsulfonylamino)benzoate (PubChem CID 67379040) has the molecular formula C17H17ClFNO4S and a molecular weight of 385.84 g/mol. Its IUPAC name is benzyl 4-chloro-2-fluoro-3-(propylsulfonylamino)benzoate.
| Compound Name | benzyl 4-chloro-2-fluoro-3-(propylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 67379040 |
| Molecular Formula | C17H17ClFNO4S |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | benzyl 4-chloro-2-fluoro-3-(propylsulfonylamino)benzoate |
| SMILES | CCCS(=O)(=O)Nc1c(Cl)ccc(C(=O)OCc2ccccc2)c1F |
| InChI | InChI=1S/C17H17ClFNO4S/c1-2-10-25(22,23)20-16-14(18)9-8-13(15(16)19)17(21)24-11-12-6-4-3-5-7-12/h3-9,20H,2,10-11H2,1H3 |
| InChIKey | QRFVFBIHESCQJU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |