About [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid
[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid (PubChem CID 67379092) has the molecular formula C18H13F2N3O3
and a molecular weight of 357.32 g/mol. Its IUPAC name is [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid.
Molecular Properties
| Compound Name | [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid |
| PubChem CID | 67379092 |
| Molecular Formula | C18H13F2N3O3 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(Cc2nn(-c3cc(F)cc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C18H13F2N3O3/c19-12-8-13(20)10-15(9-12)23-5-4-17(24)16(22-23)7-11-2-1-3-14(6-11)21-18(25)26/h1-6,8-10,21H,7H2,(H,25,26) |
| InChIKey | WNZXEIXQPOGXML-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid?
The IUPAC name of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid (CID 67379092) is [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid.
What is the SMILES notation for [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid?
The canonical SMILES for [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid is O=C(O)Nc1cccc(Cc2nn(-c3cc(F)cc(F)c3)ccc2=O)c1.
What is the InChIKey of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid?
The InChIKey is WNZXEIXQPOGXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2N3O3/c19-12-8-13(20)10-15(9-12)23-5-4-17(24)16(22-23)7-11-2-1-3-14(6-11)21-18(25)26/h1-6,8-10,21H,7H2,(H,25,26).
What are the key properties of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid?
[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid has a molecular weight of 357.32 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamic acid is sourced from PubChem (CID 67379092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).