C28H40N8O3 — CID 67379399
4-hexyl-2-[[5-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid;N-methylmethanamine (PubChem CID 67379399) has the molecular formula C28H40N8O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is 4-hexyl-2-[[5-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid;N-methylmethanamine.
| Compound Name | 4-hexyl-2-[[5-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 67379399 |
| Molecular Formula | C28H40N8O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 4-hexyl-2-[[5-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid;N-methylmethanamine |
| SMILES | CCCCCCc1nc(Nc2ccc(N3CCN4CCCCC4C3=O)cn2)nc2[nH]c(C(=O)O)cc12.CNC |
| InChI | InChI=1S/C26H33N7O3.C2H7N/c1-2-3-4-5-8-19-18-15-20(25(35)36)28-23(18)31-26(29-19)30-22-11-10-17(16-27-22)33-14-13-32-12-7-6-9-21(32)24(33)34;1-3-2/h10-11,15-16,21H,2-9,12-14H2,1H3,(H,35,36)(H2,27,28,29,30,31);3H,1-2H3 |
| InChIKey | IUHRIWVOTJMPLK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|