C32H32F2N6O2 — CID 67380304
9H-fluoren-9-ylmethyl N-[2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]carbamate (PubChem CID 67380304) has the molecular formula C32H32F2N6O2 and a molecular weight of 570.64 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 67380304 |
| Molecular Formula | C32H32F2N6O2 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]carbamate |
| SMILES | CCN1CCC(n2c(CCNC(=O)OCC3c4ccccc4-c4ccccc43)nc3cnc4[nH]ccc4c32)C(F)(F)C1 |
| InChI | InChI=1S/C32H32F2N6O2/c1-2-39-16-13-27(32(33,34)19-39)40-28(38-26-17-37-30-24(29(26)40)11-14-35-30)12-15-36-31(41)42-18-25-22-9-5-3-7-20(22)21-8-4-6-10-23(21)25/h3-11,14,17,25,27H,2,12-13,15-16,18-19H2,1H3,(H,35,37)(H,36,41) |
| InChIKey | ACSCKJQTPYAFAE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |