C18H18N4O4 — CID 67381230
1-[(10-methoxy-5-oxo-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-8-yl)methylamino]pyrrole-2,5-dione (PubChem CID 67381230) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-[(10-methoxy-5-oxo-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-8-yl)methylamino]pyrrole-2,5-dione.
| Compound Name | 1-[(10-methoxy-5-oxo-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-8-yl)methylamino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67381230 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-[(10-methoxy-5-oxo-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-8-yl)methylamino]pyrrole-2,5-dione |
| SMILES | COc1cc(CNN2C(=O)C=CC2=O)cc2[nH]c(=O)c3c(c12)NCCC3 |
| InChI | InChI=1S/C18H18N4O4/c1-26-13-8-10(9-20-22-14(23)4-5-15(22)24)7-12-16(13)17-11(18(25)21-12)3-2-6-19-17/h4-5,7-8,19-20H,2-3,6,9H2,1H3,(H,21,25) |
| InChIKey | GTEZCMKPSZKSDV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|