C17H25Cl2N3O2 — CID 67381374
8-[(3-methoxypropylamino)methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one;dihydrochloride (PubChem CID 67381374) has the molecular formula C17H25Cl2N3O2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 8-[(3-methoxypropylamino)methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one;dihydrochloride.
| Compound Name | 8-[(3-methoxypropylamino)methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one;dihydrochloride |
|---|---|
| PubChem CID | 67381374 |
| Molecular Formula | C17H25Cl2N3O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 8-[(3-methoxypropylamino)methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one;dihydrochloride |
| SMILES | COCCCNCc1ccc2c3c(c(=O)[nH]c2c1)CCCN3.Cl.Cl |
| InChI | InChI=1S/C17H23N3O2.2ClH/c1-22-9-3-7-18-11-12-5-6-13-15(10-12)20-17(21)14-4-2-8-19-16(13)14;;/h5-6,10,18-19H,2-4,7-9,11H2,1H3,(H,20,21);2*1H |
| InChIKey | XAGMJMDMRRWALI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|