C34H42B2FNO4 — CID 67381867
1-(4-fluorophenyl)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine (PubChem CID 67381867) has the molecular formula C34H42B2FNO4 and a molecular weight of 569.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine.
| Compound Name | 1-(4-fluorophenyl)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 67381867 |
| Molecular Formula | C34H42B2FNO4 |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | 1-(4-fluorophenyl)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
| SMILES | CC1(C)OB(c2ccc(C3CCC(c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)N3c3ccc(F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C34H42B2FNO4/c1-31(2)32(3,4)40-35(39-31)25-13-9-23(10-14-25)29-21-22-30(38(29)28-19-17-27(37)18-20-28)24-11-15-26(16-12-24)36-41-33(5,6)34(7,8)42-36/h9-20,29-30H,21-22H2,1-8H3 |
| InChIKey | CJXQPWHIDQJGLV-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|