About benzene-1,2-diol;4-chloro-3-methylphenol
benzene-1,2-diol;4-chloro-3-methylphenol (PubChem CID 67381878) has the molecular formula C13H13ClO3
and a molecular weight of 252.70 g/mol. Its IUPAC name is benzene-1,2-diol;4-chloro-3-methylphenol.
Molecular Properties
| Compound Name | benzene-1,2-diol;4-chloro-3-methylphenol |
| PubChem CID | 67381878 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | benzene-1,2-diol;4-chloro-3-methylphenol |
| SMILES | Cc1cc(O)ccc1Cl.Oc1ccccc1O |
| InChI | InChI=1S/C7H7ClO.C6H6O2/c1-5-4-6(9)2-3-7(5)8;7-5-3-1-2-4-6(5)8/h2-4,9H,1H3;1-4,7-8H |
| InChIKey | OYAQPYIJQDBSGB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;4-chloro-3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;4-chloro-3-methylphenol?
The IUPAC name of benzene-1,2-diol;4-chloro-3-methylphenol (CID 67381878) is benzene-1,2-diol;4-chloro-3-methylphenol.
What is the SMILES notation for benzene-1,2-diol;4-chloro-3-methylphenol?
The canonical SMILES for benzene-1,2-diol;4-chloro-3-methylphenol is Cc1cc(O)ccc1Cl.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;4-chloro-3-methylphenol?
The InChIKey is OYAQPYIJQDBSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO.C6H6O2/c1-5-4-6(9)2-3-7(5)8;7-5-3-1-2-4-6(5)8/h2-4,9H,1H3;1-4,7-8H.
What are the key properties of benzene-1,2-diol;4-chloro-3-methylphenol?
benzene-1,2-diol;4-chloro-3-methylphenol has a molecular weight of 252.70 g/mol, XLogP of 3.45, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;4-chloro-3-methylphenol is sourced from PubChem (CID 67381878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).