About 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one
1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one (PubChem CID 67382111) has the molecular formula C20H25N5O2
and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one |
| PubChem CID | 67382111 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one |
| SMILES | CCOCc1nc2cnc3cc(N4CCCC4=O)cnc3c2n1CC(C)C |
| InChI | InChI=1S/C20H25N5O2/c1-4-27-12-17-23-16-10-21-15-8-14(24-7-5-6-18(24)26)9-22-19(15)20(16)25(17)11-13(2)3/h8-10,13H,4-7,11-12H2,1-3H3 |
| InChIKey | MUJQGRPETBESDD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one?
The IUPAC name of 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one (CID 67382111) is 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one.
What is the SMILES notation for 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one?
The canonical SMILES for 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one is CCOCc1nc2cnc3cc(N4CCCC4=O)cnc3c2n1CC(C)C.
What is the InChIKey of 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one?
The InChIKey is MUJQGRPETBESDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5O2/c1-4-27-12-17-23-16-10-21-15-8-14(24-7-5-6-18(24)26)9-22-19(15)20(16)25(17)11-13(2)3/h8-10,13H,4-7,11-12H2,1-3H3.
What are the key properties of 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one?
1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one has a molecular weight of 367.45 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(ethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-7-yl]pyrrolidin-2-one is sourced from PubChem (CID 67382111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).