C31H44N2O5Si — CID 67382124
7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoic acid (PubChem CID 67382124) has the molecular formula C31H44N2O5Si and a molecular weight of 552.79 g/mol. Its IUPAC name is 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoic acid.
| Compound Name | 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 67382124 |
| Molecular Formula | C31H44N2O5Si |
| Molecular Weight | 552.79 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoic acid |
| SMILES | CCC1(CCCCCC(C(=O)O)c2ncc(-c3ccc4ccccc4c3)n2COCC[Si](C)(C)C)OCCO1 |
| InChI | InChI=1S/C31H44N2O5Si/c1-5-31(37-17-18-38-31)16-10-6-7-13-27(30(34)35)29-32-22-28(33(29)23-36-19-20-39(2,3)4)26-15-14-24-11-8-9-12-25(24)21-26/h8-9,11-12,14-15,21-22,27H,5-7,10,13,16-20,23H2,1-4H3,(H,34,35) |
| InChIKey | JCPYRWKXAYDECK-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|