C25H32N2O3 — CID 67382133
7-(2-ethyl-1,3-dioxolan-2-yl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptan-1-ol (PubChem CID 67382133) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 7-(2-ethyl-1,3-dioxolan-2-yl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptan-1-ol.
| Compound Name | 7-(2-ethyl-1,3-dioxolan-2-yl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptan-1-ol |
|---|---|
| PubChem CID | 67382133 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 7-(2-ethyl-1,3-dioxolan-2-yl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptan-1-ol |
| SMILES | CCC1(CCCCCC(CO)c2ncc(-c3ccc4ccccc4c3)[nH]2)OCCO1 |
| InChI | InChI=1S/C25H32N2O3/c1-2-25(29-14-15-30-25)13-7-3-4-10-22(18-28)24-26-17-23(27-24)21-12-11-19-8-5-6-9-20(19)16-21/h5-6,8-9,11-12,16-17,22,28H,2-4,7,10,13-15,18H2,1H3,(H,26,27) |
| InChIKey | SASKWWCDEZHHNX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|