C31H46N2O4Si — CID 67382322
7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptan-1-ol (PubChem CID 67382322) has the molecular formula C31H46N2O4Si and a molecular weight of 538.81 g/mol. Its IUPAC name is 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptan-1-ol.
| Compound Name | 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptan-1-ol |
|---|---|
| PubChem CID | 67382322 |
| Molecular Formula | C31H46N2O4Si |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptan-1-ol |
| SMILES | CCC1(CCCCCC(CO)c2ncc(-c3ccc4ccccc4c3)n2COCC[Si](C)(C)C)OCCO1 |
| InChI | InChI=1S/C31H46N2O4Si/c1-5-31(36-17-18-37-31)16-10-6-7-13-28(23-34)30-32-22-29(33(30)24-35-19-20-38(2,3)4)27-15-14-25-11-8-9-12-26(25)21-27/h8-9,11-12,14-15,21-22,28,34H,5-7,10,13,16-20,23-24H2,1-4H3 |
| InChIKey | CAHZRZXJBPCPTI-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|