C11H13FN2O4 — CID 67382767
2-ethyl-2-(2-ethyl-5-fluoropyrimidin-4-yl)propanedioic acid (PubChem CID 67382767) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is 2-ethyl-2-(2-ethyl-5-fluoropyrimidin-4-yl)propanedioic acid.
| Compound Name | 2-ethyl-2-(2-ethyl-5-fluoropyrimidin-4-yl)propanedioic acid |
|---|---|
| PubChem CID | 67382767 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-ethyl-2-(2-ethyl-5-fluoropyrimidin-4-yl)propanedioic acid |
| SMILES | CCc1ncc(F)c(C(CC)(C(=O)O)C(=O)O)n1 |
| InChI | InChI=1S/C11H13FN2O4/c1-3-7-13-5-6(12)8(14-7)11(4-2,9(15)16)10(17)18/h5H,3-4H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | KWOZGFSSNKIMJJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|