C23H23N5O — CID 67382866
4-[2-(1H-imidazol-5-yl)-2-[4-(2-methylphenyl)-3-oxopiperazin-1-yl]ethyl]benzonitrile (PubChem CID 67382866) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-[2-(1H-imidazol-5-yl)-2-[4-(2-methylphenyl)-3-oxopiperazin-1-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-(1H-imidazol-5-yl)-2-[4-(2-methylphenyl)-3-oxopiperazin-1-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 67382866 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-[2-(1H-imidazol-5-yl)-2-[4-(2-methylphenyl)-3-oxopiperazin-1-yl]ethyl]benzonitrile |
| SMILES | Cc1ccccc1N1CCN(C(Cc2ccc(C#N)cc2)c2cnc[nH]2)CC1=O |
| InChI | InChI=1S/C23H23N5O/c1-17-4-2-3-5-21(17)28-11-10-27(15-23(28)29)22(20-14-25-16-26-20)12-18-6-8-19(13-24)9-7-18/h2-9,14,16,22H,10-12,15H2,1H3,(H,25,26) |
| InChIKey | QTTBCQYAGNNNDF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |