C13H10BrF2NO2 — CID 67383458
(5-bromo-2-methoxyphenyl)-(2,6-difluoro-3-pyridinyl)methanol (PubChem CID 67383458) has the molecular formula C13H10BrF2NO2 and a molecular weight of 330.13 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)-(2,6-difluoro-3-pyridinyl)methanol.
| Compound Name | (5-bromo-2-methoxyphenyl)-(2,6-difluoro-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 67383458 |
| Molecular Formula | C13H10BrF2NO2 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)-(2,6-difluoro-3-pyridinyl)methanol |
| SMILES | COc1ccc(Br)cc1C(O)c1ccc(F)nc1F |
| InChI | InChI=1S/C13H10BrF2NO2/c1-19-10-4-2-7(14)6-9(10)12(18)8-3-5-11(15)17-13(8)16/h2-6,12,18H,1H3 |
| InChIKey | LMDVVGWJICNSEB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|