C12H10N2O3 — CID 67383465
2,3-dihydro-[1,4]dioxino[2,3-g]quinoline-9-carboxamide (PubChem CID 67383465) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-g]quinoline-9-carboxamide.
| Compound Name | 2,3-dihydro-[1,4]dioxino[2,3-g]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 67383465 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2,3-dihydro-[1,4]dioxino[2,3-g]quinoline-9-carboxamide |
| SMILES | NC(=O)c1ccnc2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C12H10N2O3/c13-12(15)7-1-2-14-9-6-11-10(5-8(7)9)16-3-4-17-11/h1-2,5-6H,3-4H2,(H2,13,15) |
| InChIKey | TULZEEAZJOUHOO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |