C17H13F3N2O3 — CID 67383653
1'-(2,2,2-trifluoroethoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 67383653) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 1'-(2,2,2-trifluoroethoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | 1'-(2,2,2-trifluoroethoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 67383653 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1'-(2,2,2-trifluoroethoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | NC1=NC2(CO1)c1ccccc1Oc1cccc(OCC(F)(F)F)c12 |
| InChI | InChI=1S/C17H13F3N2O3/c18-17(19,20)9-23-12-6-3-7-13-14(12)16(8-24-15(21)22-16)10-4-1-2-5-11(10)25-13/h1-7H,8-9H2,(H2,21,22) |
| InChIKey | WSRFIZQHWHKENQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |