C16H8N4S3 — CID 67384162
4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 67384162) has the molecular formula C16H8N4S3 and a molecular weight of 352.47 g/mol. Its IUPAC name is 4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 67384162 |
| Molecular Formula | C16H8N4S3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | c1csc(-c2c3nccnc3c(-c3cccs3)c3nsnc23)c1 |
| InChI | InChI=1S/C16H8N4S3/c1-3-9(21-7-1)11-13-14(18-6-5-17-13)12(10-4-2-8-22-10)16-15(11)19-23-20-16/h1-8H |
| InChIKey | UFEGJSRIXAMOHZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |