C20H25N3O3 — CID 67384624
methyl 2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-3-phenylpropanoate (PubChem CID 67384624) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67384624 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | methyl 2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NCc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C20H25N3O3/c1-25-20(24)18(13-16-5-3-2-4-6-16)21-14-17-7-8-19(22-15-17)23-9-11-26-12-10-23/h2-8,15,18,21H,9-14H2,1H3 |
| InChIKey | YXDWSEPDCJUQMJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |