C7H12N2S — CID 67384843
2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine (PubChem CID 67384843) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine.
| Compound Name | 2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 67384843 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine |
| SMILES | NC1NC2=C(CCCC2)S1 |
| InChI | InChI=1S/C7H12N2S/c8-7-9-5-3-1-2-4-6(5)10-7/h7,9H,1-4,8H2 |
| InChIKey | LMAGIZHMMAWWGJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |