C19H29F3N6O4SSi — CID 67385308
1-[1-(trifluoromethylsulfonyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385308) has the molecular formula C19H29F3N6O4SSi and a molecular weight of 522.63 g/mol. Its IUPAC name is 1-[1-(trifluoromethylsulfonyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[1-(trifluoromethylsulfonyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385308 |
| Molecular Formula | C19H29F3N6O4SSi |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 1-[1-(trifluoromethylsulfonyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)NC3CCCN(S(=O)(=O)C(F)(F)F)C3)cnc21 |
| InChI | InChI=1S/C19H29F3N6O4SSi/c1-34(2,3)10-9-32-13-27-8-6-15-17(27)23-11-16(25-15)26-18(29)24-14-5-4-7-28(12-14)33(30,31)19(20,21)22/h6,8,11,14H,4-5,7,9-10,12-13H2,1-3H3,(H2,24,25,26,29) |
| InChIKey | RDVJWFOTWBQTTF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|