About tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate
tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate (PubChem CID 67385359) has the molecular formula C31H40N2O4
and a molecular weight of 504.67 g/mol. Its IUPAC name is tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate |
| PubChem CID | 67385359 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate |
| SMILES | CCOc1c(-c2ccccc2)c(-c2ccccc2)nn1CC1CCC(COCC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H40N2O4/c1-5-36-30-28(25-12-8-6-9-13-25)29(26-14-10-7-11-15-26)32-33(30)20-23-16-18-24(19-17-23)21-35-22-27(34)37-31(2,3)4/h6-15,23-24H,5,16-22H2,1-4H3 |
| InChIKey | VORRXUWZJHPTTN-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate?
The IUPAC name of tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate (CID 67385359) is tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate.
What is the SMILES notation for tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate?
The canonical SMILES for tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate is CCOc1c(-c2ccccc2)c(-c2ccccc2)nn1CC1CCC(COCC(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate?
The InChIKey is VORRXUWZJHPTTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H40N2O4/c1-5-36-30-28(25-12-8-6-9-13-25)29(26-14-10-7-11-15-26)32-33(30)20-23-16-18-24(19-17-23)21-35-22-27(34)37-31(2,3)4/h6-15,23-24H,5,16-22H2,1-4H3.
What are the key properties of tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate?
tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate has a molecular weight of 504.67 g/mol, XLogP of 6.78, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[[4-[(5-ethoxy-3,4-diphenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate is sourced from PubChem (CID 67385359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).