About [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane
[4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 67385362) has the molecular formula C28H42O5S2Si
and a molecular weight of 550.86 g/mol. Its IUPAC name is [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane |
| PubChem CID | 67385362 |
| Molecular Formula | C28H42O5S2Si |
| Molecular Weight | 550.86 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)CC2(CS(=O)(=O)c3ccc(C)cc3)CCC(O[Si](C)(C)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C28H42O5S2Si/c1-22-8-12-25(13-9-22)34(29,30)20-28(21-35(31,32)26-14-10-23(2)11-15-26)18-16-24(17-19-28)33-36(6,7)27(3,4)5/h8-15,24H,16-21H2,1-7H3 |
| InChIKey | XHXGPMDQVJNJCO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.86 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane?
The IUPAC name of [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane (CID 67385362) is [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane?
The canonical SMILES for [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane is Cc1ccc(S(=O)(=O)CC2(CS(=O)(=O)c3ccc(C)cc3)CCC(O[Si](C)(C)C(C)(C)C)CC2)cc1.
What is the InChIKey of [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane?
The InChIKey is XHXGPMDQVJNJCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42O5S2Si/c1-22-8-12-25(13-9-22)34(29,30)20-28(21-35(31,32)26-14-10-23(2)11-15-26)18-16-24(17-19-28)33-36(6,7)27(3,4)5/h8-15,24H,16-21H2,1-7H3.
What are the key properties of [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane?
[4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane has a molecular weight of 550.86 g/mol, XLogP of 6.50, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexyl]oxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 67385362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).