C25H35IN2O3S — CID 67385569
tert-butyl 2-[[4-[(5-ethylsulfanyl-4-iodo-3-phenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate (PubChem CID 67385569) has the molecular formula C25H35IN2O3S and a molecular weight of 570.54 g/mol. Its IUPAC name is tert-butyl 2-[[4-[(5-ethylsulfanyl-4-iodo-3-phenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[4-[(5-ethylsulfanyl-4-iodo-3-phenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate |
|---|---|
| PubChem CID | 67385569 |
| Molecular Formula | C25H35IN2O3S |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | tert-butyl 2-[[4-[(5-ethylsulfanyl-4-iodo-3-phenylpyrazol-1-yl)methyl]cyclohexyl]methoxy]acetate |
| SMILES | CCSc1c(I)c(-c2ccccc2)nn1CC1CCC(COCC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H35IN2O3S/c1-5-32-24-22(26)23(20-9-7-6-8-10-20)27-28(24)15-18-11-13-19(14-12-18)16-30-17-21(29)31-25(2,3)4/h6-10,18-19H,5,11-17H2,1-4H3 |
| InChIKey | FUXAXSOSCBINOS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|