C29H31F3N6O4 — CID 67385607
[3-[7-[2-(2,6-dimethylmorpholin-4-yl)-4-pyridinyl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 67385607) has the molecular formula C29H31F3N6O4 and a molecular weight of 584.60 g/mol. Its IUPAC name is [3-[7-[2-(2,6-dimethylmorpholin-4-yl)-4-pyridinyl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[7-[2-(2,6-dimethylmorpholin-4-yl)-4-pyridinyl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67385607 |
| Molecular Formula | C29H31F3N6O4 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | [3-[7-[2-(2,6-dimethylmorpholin-4-yl)-4-pyridinyl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | CC1CN(c2cc(N3CCc4c(-c5cccc(OC(=O)C(F)(F)F)c5)nc(N5CCOCC5)nc43)ccn2)CC(C)O1 |
| InChI | InChI=1S/C29H31F3N6O4/c1-18-16-37(17-19(2)41-18)24-15-21(6-8-33-24)38-9-7-23-25(34-28(35-26(23)38)36-10-12-40-13-11-36)20-4-3-5-22(14-20)42-27(39)29(30,31)32/h3-6,8,14-15,18-19H,7,9-13,16-17H2,1-2H3 |
| InChIKey | FUTLNSXUSWINKO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|