C44H51N9O5 — CID 67385661
4-[4-[2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-5-yl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 67385661) has the molecular formula C44H51N9O5 and a molecular weight of 785.95 g/mol. Its IUPAC name is 4-[4-[2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-5-yl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 4-[4-[2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-5-yl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 67385661 |
| Molecular Formula | C44H51N9O5 |
| Molecular Weight | 785.95 g/mol |
| Exact Mass | 785.40 |
| IUPAC Name | 4-[4-[2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-5-yl]-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ncc(-c3nc(N4CCOCC4)nc4c3CCN4c3ccc(C(=O)NCCCN4CCOCC4)cc3)cn2)cc1 |
| InChI | InChI=1S/C44H51N9O5/c1-55-37-12-4-32(5-13-37)30-52(31-33-6-14-38(56-2)15-7-33)43-46-28-35(29-47-43)40-39-16-19-53(41(39)49-44(48-40)51-22-26-58-27-23-51)36-10-8-34(9-11-36)42(54)45-17-3-18-50-20-24-57-25-21-50/h4-15,28-29H,3,16-27,30-31H2,1-2H3,(H,45,54) |
| InChIKey | CGHCMNNKTWYMBB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 130.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.95 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|