C20H31F3N6O4SSi — CID 67385742
1-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385742) has the molecular formula C20H31F3N6O4SSi and a molecular weight of 536.65 g/mol. Its IUPAC name is 1-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385742 |
| Molecular Formula | C20H31F3N6O4SSi |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 1-[(3R)-1-(3,3,3-trifluoropropylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)N[C@@H]3CCN(S(=O)(=O)CCC(F)(F)F)C3)cnc21 |
| InChI | InChI=1S/C20H31F3N6O4SSi/c1-35(2,3)11-9-33-14-28-7-5-16-18(28)24-12-17(26-16)27-19(30)25-15-4-8-29(13-15)34(31,32)10-6-20(21,22)23/h5,7,12,15H,4,6,8-11,13-14H2,1-3H3,(H2,25,26,27,30)/t15-/m1/s1 |
| InChIKey | ZXMFPCYGQPSNKS-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|