C21H33F3N6O2Si — CID 67385800
1-[[1-(2,2,2-trifluoroethyl)piperidin-2-yl]methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385800) has the molecular formula C21H33F3N6O2Si and a molecular weight of 486.62 g/mol. Its IUPAC name is 1-[[1-(2,2,2-trifluoroethyl)piperidin-2-yl]methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[[1-(2,2,2-trifluoroethyl)piperidin-2-yl]methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385800 |
| Molecular Formula | C21H33F3N6O2Si |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1-[[1-(2,2,2-trifluoroethyl)piperidin-2-yl]methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)NCC3CCCCN3CC(F)(F)F)cnc21 |
| InChI | InChI=1S/C21H33F3N6O2Si/c1-33(2,3)11-10-32-15-30-9-7-17-19(30)25-13-18(27-17)28-20(31)26-12-16-6-4-5-8-29(16)14-21(22,23)24/h7,9,13,16H,4-6,8,10-12,14-15H2,1-3H3,(H2,26,27,28,31) |
| InChIKey | QXYSOBUXLXLJQA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|