C22H35F3N6O2Si — CID 67385946
1-[2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385946) has the molecular formula C22H35F3N6O2Si and a molecular weight of 500.64 g/mol. Its IUPAC name is 1-[2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385946 |
| Molecular Formula | C22H35F3N6O2Si |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 1-[2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)NCCC3CCCN(CC(F)(F)F)C3)cnc21 |
| InChI | InChI=1S/C22H35F3N6O2Si/c1-34(2,3)12-11-33-16-31-10-7-18-20(31)27-13-19(28-18)29-21(32)26-8-6-17-5-4-9-30(14-17)15-22(23,24)25/h7,10,13,17H,4-6,8-9,11-12,14-16H2,1-3H3,(H2,26,28,29,32) |
| InChIKey | LRCIIUQFMATCTF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|