About 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine
1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine (PubChem CID 67387431) has the molecular formula C16H14N2O2S
and a molecular weight of 298.37 g/mol. Its IUPAC name is 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine.
Molecular Properties
| Compound Name | 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine |
| PubChem CID | 67387431 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine |
| SMILES | COc1cccc2c1C1(CSC(N)=N1)c1ccccc1O2 |
| InChI | InChI=1S/C16H14N2O2S/c1-19-12-7-4-8-13-14(12)16(9-21-15(17)18-16)10-5-2-3-6-11(10)20-13/h2-8H,9H2,1H3,(H2,17,18) |
| InChIKey | FRDMUEGODUHKCZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
The IUPAC name of 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine (CID 67387431) is 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine.
What is the SMILES notation for 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
The canonical SMILES for 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine is COc1cccc2c1C1(CSC(N)=N1)c1ccccc1O2.
What is the InChIKey of 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
The InChIKey is FRDMUEGODUHKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2S/c1-19-12-7-4-8-13-14(12)16(9-21-15(17)18-16)10-5-2-3-6-11(10)20-13/h2-8H,9H2,1H3,(H2,17,18).
What are the key properties of 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine has a molecular weight of 298.37 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methoxyspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine is sourced from PubChem (CID 67387431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).